4,4′-dichlorodiphenylmethanol

structural formula
| business number | 022v |
|---|---|
| molecular formula | c13h10cl2o |
| molecular weight | 253.12 |
| label |
4,4′-dichlorodibenzyl alcohol, bis(4-chlorophenyl)carbinol, (clc6h4)2choh |
numbering system
cas number:90-97-1
mdl number:mfcd00000629
einecs number:202-029-6
rtecs number:none
brn number:1878717
pubchem number:24847134
physical property data
1. characteristics: milky white to light brown powder.
2. density ( g/ml,25/4℃) : undetermined
3. relative vapor density (g/ml,air=1): undetermined
4. melting point ( ºc) : 91-95
5. boiling point ( ºc,normal pressure): undetermined
6. boiling point ( ºc,5.2kpa): undetermined
7. refractive index: undetermined
8. flashpoint (ºc): undetermined
9. specific optical rotation (º): undetermined
10. autoignition point or ignition temperature (ºc): not ok
11. vapor pressure (kpa,25ºc): undetermined
12. explosion limit (%,v/v): undetermined
18. lower explosion limit (%,v/v): not ok
19. solubility: undetermined
toxicological data
none
ecological data
none
molecular structure data
1. molar refractive index:66.89
2. molar volume (m3/mol):190.9
3. isotonic specific volume (90.2k): 505.4
4. surface tension (dyne/cm): 49.0
5. polarizability(10-24 cm3):26.51
compute chemical data
1. reference value for hydrophobic parameter calculation (xlogp): none
2. number of hydrogen bond donors: 1
3. number of hydrogen bond acceptors: 1
4. number of rotatable chemical bonds: 2
5. number of tautomers: none
6. topological molecule polar surface area 20.2
7. number of heavy atoms: 16
8. surface charge: 0
9. complexity: 184
10. number of isotope atoms: 0
11. determine the number of atomic stereocenters: 0
12. uncertain number of atomic stereocenters: 0
13. determine the number of chemical bond stereocenters: 0
14. number of uncertain chemical bond stereocenters: 0
15. number of covalent bond units: 1
properties and stability
none
storage method
this product should be sealed and stored in a cool place.
synthesis method
none
purpose
organic synthesis.
yle=”font-size: 9pt; font-family: 宋体; mso-ascii-font-family: arial; mso-hansi-font-family: arial; mso-bidi-font-family: arial”>):505.4
4. surface tension (dyne/cm): 49.0
5. polarizability(10-24 cm3):26.51
compute chemical data
1. reference value for hydrophobic parameter calculation (xlogp): none
2. number of hydrogen bond donors: 1
3. number of hydrogen bond acceptors: 1
4. number of rotatable chemical bonds: 2
5. number of tautomers: none
6. topological molecule polar surface area 20.2
7. number of heavy atoms: 16
8. surface charge: 0
9. complexity: 184
10. number of isotope atoms: 0
11. determine the number of atomic stereocenters: 0
12. uncertain number of atomic stereocenters: 0
13. determine the number of chemical bond stereocenters: 0
14. number of uncertain chemical bond stereocenters: 0
15. number of covalent bond units: 1
properties and stability
none
storage method
this product should be sealed and stored in a cool place.
synthesis method
none
purpose
organic synthesis.
