dibutyl phosphate di-n-butyl phosphate

structural formula
| business number | 02vl |
|---|---|
| molecular formula | c8h19o4p |
| molecular weight | 210.21 |
| label |
di-n-butyl phosphate, dibutyl phosphate, di-n-butyl phosphate, phosphoric acid dibutyl ester, dibutyl phosphate(ch3ch2ch2ch2o)2p(o)oh, extraction agent for uranium and thorium, gas chromatography stationary solution |
numbering system
cas number:107-66-4
mdl number:mfcd00015245
einecs number:203-509-8
rtecs number:tb9605000
brn number:607224
pubchem number:24861550
physical property data
1. properties: colorless to light yellow viscous liquid.
2. density (g/ml, 20/4℃): 1.060
3. relative vapor density (g/ml, air=1): undetermined
4. melting point (ºc): -13
5. boiling point (ºc, normal pressure): 250
6. boiling point (ºc, kpa): undetermined
p>
7. refractive index (20ºc): 1.428
8. flash point (ºc): 157
9. specific rotation (ºc): undetermined
7. p>
10. autoignition point or ignition temperature (ºc): 420
11. vapor pressure (mmhg, ºc): undetermined
12. saturated vapor pressure ( kpa, ºc): undetermined
13. heat of combustion (kj/mol): undetermined
14. critical temperature (ºc): undetermined
15. critical pressure (kpa): undetermined
16. log value of oil-water (octanol/water) distribution coefficient: undetermined
17. explosion upper limit (%, v/ v): undetermined
18. lower explosion limit (%, v/v): undetermined
19. solubility: soluble in ether, carbon tetrachloride and various organic solvent.
toxicological data
toxic if taken orally.
ecological data
generally speaking, it is not harmful to water bodies.
molecular structure data
1. molar refractive index: 51.01
2. molar volume (cm3/mol): 194.9
3. isotonic specific volume (90.2k ): 478.6
4. surface tension (dyne/cm): 36.3
5. dielectric constant:
6. dipole moment (10-24cm3):
7. polarizability: 20.22
compute chemical data
1. hydrophobic parameter calculation reference value (xlogp): 1.5
2. number of hydrogen bond donors: 1
3. number of hydrogen bond acceptors: 4
4. number of rotatable chemical bonds: 8
5. number of tautomers:
6. topology molecular polar surface area (tpsa): 55.8
7, number of heavy atoms: 13
8, surface charge: 0
9, complexity: 146
10. number of isotope atoms: 0
11. number of determined atomic stereocenters: 0
12. number of uncertain atomic stereocenters: 0
p>
13. the number of determined stereocenters of chemical bonds: 0
14. the number of uncertain stereocenters of chemical bonds: 0
15. the number of covalent bond units: 1
properties and stability
avoid contact with strong oxidants, alkalis, and reactive metals. when using, avoid inhaling the vapor of this product and avoid contact with eyes and skin.
storage method
stored in a cool, dry and well-ventilated warehouse. keep away from fire and heat sources. keep container tightly sealed. should be kept away from oxidizer, do not store together. use explosion-proof lighting and ventilation facilities. it is prohibited to use mechanical equipment and tools that are prone to sparks. the storage area should be equipped with emergency release equipment and suitable containment materials.
synthesis method
none
purpose
used as solvent, extraction agent for uranium and thorium, and gas chromatography stationary liquid.